C25H38N4O3 — CID 111241693
1-[2-(3,4-dimethoxyphenyl)ethyl]-2-[[2-[2-(dimethylamino)ethoxy]phenyl]methyl]-3-ethyl-1-methylguanidine (PubChem CID 111241693) has the molecular formula C25H38N4O3 and a molecular weight of 442.60 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethyl]-2-[[2-[2-(dimethylamino)ethoxy]phenyl]methyl]-3-ethyl-1-methylguanidine.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-2-[[2-[2-(dimethylamino)ethoxy]phenyl]methyl]-3-ethyl-1-methylguanidine |
|---|---|
| PubChem CID | 111241693 |
| Molecular Formula | C25H38N4O3 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.29 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-2-[[2-[2-(dimethylamino)ethoxy]phenyl]methyl]-3-ethyl-1-methylguanidine |
| SMILES | CCN/C(=N\Cc1ccccc1OCCN(C)C)N(C)CCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C25H38N4O3/c1-7-26-25(27-19-21-10-8-9-11-22(21)32-17-16-28(2)3)29(4)15-14-20-12-13-23(30-5)24(18-20)31-6/h8-13,18H,7,14-17,19H2,1-6H3,(H,26,27) |
| InChIKey | NYQGKLIHYKLVEY-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|