C23H34IN3O4 — CID 111419554
3-ethyl-2-[[4-(2-hydroxyethoxy)-3-methoxyphenyl]methyl]-1-methyl-1-[2-(2-methylphenoxy)ethyl]guanidine;hydroiodide (PubChem CID 111419554) has the molecular formula C23H34IN3O4 and a molecular weight of 543.45 g/mol. Its IUPAC name is 3-ethyl-2-[[4-(2-hydroxyethoxy)-3-methoxyphenyl]methyl]-1-methyl-1-[2-(2-methylphenoxy)ethyl]guanidine;hydroiodide.
| Compound Name | 3-ethyl-2-[[4-(2-hydroxyethoxy)-3-methoxyphenyl]methyl]-1-methyl-1-[2-(2-methylphenoxy)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111419554 |
| Molecular Formula | C23H34IN3O4 |
| Molecular Weight | 543.45 g/mol |
| Exact Mass | 543.16 |
| IUPAC Name | 3-ethyl-2-[[4-(2-hydroxyethoxy)-3-methoxyphenyl]methyl]-1-methyl-1-[2-(2-methylphenoxy)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(OCCO)c(OC)c1)N(C)CCOc1ccccc1C.I |
| InChI | InChI=1S/C23H33N3O4.HI/c1-5-24-23(26(3)12-14-29-20-9-7-6-8-18(20)2)25-17-19-10-11-21(30-15-13-27)22(16-19)28-4;/h6-11,16,27H,5,12-15,17H2,1-4H3,(H,24,25);1H |
| InChIKey | JDJJQWVFSLRXML-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.45 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|