C23H33N3O4 — CID 111274673
1-[(4-ethoxyphenyl)methyl]-3-ethyl-2-[[4-(2-hydroxyethoxy)-3-methoxyphenyl]methyl]-1-methylguanidine (PubChem CID 111274673) has the molecular formula C23H33N3O4 and a molecular weight of 415.53 g/mol. Its IUPAC name is 1-[(4-ethoxyphenyl)methyl]-3-ethyl-2-[[4-(2-hydroxyethoxy)-3-methoxyphenyl]methyl]-1-methylguanidine.
| Compound Name | 1-[(4-ethoxyphenyl)methyl]-3-ethyl-2-[[4-(2-hydroxyethoxy)-3-methoxyphenyl]methyl]-1-methylguanidine |
|---|---|
| PubChem CID | 111274673 |
| Molecular Formula | C23H33N3O4 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.25 |
| IUPAC Name | 1-[(4-ethoxyphenyl)methyl]-3-ethyl-2-[[4-(2-hydroxyethoxy)-3-methoxyphenyl]methyl]-1-methylguanidine |
| SMILES | CCN/C(=N\Cc1ccc(OCCO)c(OC)c1)N(C)Cc1ccc(OCC)cc1 |
| InChI | InChI=1S/C23H33N3O4/c1-5-24-23(26(3)17-18-7-10-20(11-8-18)29-6-2)25-16-19-9-12-21(30-14-13-27)22(15-19)28-4/h7-12,15,27H,5-6,13-14,16-17H2,1-4H3,(H,24,25) |
| InChIKey | BIDUTZMSGMEEIJ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|