C22H30IN3O5 — CID 111367926
1-(1,3-benzodioxol-5-ylmethyl)-3-ethyl-2-[[4-(2-hydroxyethoxy)-3-methoxyphenyl]methyl]-1-methylguanidine;hydroiodide (PubChem CID 111367926) has the molecular formula C22H30IN3O5 and a molecular weight of 543.40 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-3-ethyl-2-[[4-(2-hydroxyethoxy)-3-methoxyphenyl]methyl]-1-methylguanidine;hydroiodide.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-ethyl-2-[[4-(2-hydroxyethoxy)-3-methoxyphenyl]methyl]-1-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111367926 |
| Molecular Formula | C22H30IN3O5 |
| Molecular Weight | 543.40 g/mol |
| Exact Mass | 543.12 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-ethyl-2-[[4-(2-hydroxyethoxy)-3-methoxyphenyl]methyl]-1-methylguanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(OCCO)c(OC)c1)N(C)Cc1ccc2c(c1)OCO2.I |
| InChI | InChI=1S/C22H29N3O5.HI/c1-4-23-22(25(2)14-17-6-8-19-21(12-17)30-15-29-19)24-13-16-5-7-18(28-10-9-26)20(11-16)27-3;/h5-8,11-12,26H,4,9-10,13-15H2,1-3H3,(H,23,24);1H |
| InChIKey | HZAYAMYTJSESRW-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 84.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.40 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|