C20H27N3O3 — CID 111066693
3-benzyl-2-[[4-(2-hydroxyethoxy)-3-methoxyphenyl]methyl]-1,1-dimethylguanidine (PubChem CID 111066693) has the molecular formula C20H27N3O3 and a molecular weight of 357.45 g/mol. Its IUPAC name is 3-benzyl-2-[[4-(2-hydroxyethoxy)-3-methoxyphenyl]methyl]-1,1-dimethylguanidine.
| Compound Name | 3-benzyl-2-[[4-(2-hydroxyethoxy)-3-methoxyphenyl]methyl]-1,1-dimethylguanidine |
|---|---|
| PubChem CID | 111066693 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | 3-benzyl-2-[[4-(2-hydroxyethoxy)-3-methoxyphenyl]methyl]-1,1-dimethylguanidine |
| SMILES | COc1cc(C/N=C(/NCc2ccccc2)N(C)C)ccc1OCCO |
| InChI | InChI=1S/C20H27N3O3/c1-23(2)20(21-14-16-7-5-4-6-8-16)22-15-17-9-10-18(26-12-11-24)19(13-17)25-3/h4-10,13,24H,11-12,14-15H2,1-3H3,(H,21,22) |
| InChIKey | MUEGXZSIYQTCCB-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|