C21H29N3O2 — CID 111085135
2-benzyl-3-[3-(3,4-dimethoxyphenyl)propyl]-1,1-dimethylguanidine (PubChem CID 111085135) has the molecular formula C21H29N3O2 and a molecular weight of 355.48 g/mol. Its IUPAC name is 2-benzyl-3-[3-(3,4-dimethoxyphenyl)propyl]-1,1-dimethylguanidine.
| Compound Name | 2-benzyl-3-[3-(3,4-dimethoxyphenyl)propyl]-1,1-dimethylguanidine |
|---|---|
| PubChem CID | 111085135 |
| Molecular Formula | C21H29N3O2 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | 2-benzyl-3-[3-(3,4-dimethoxyphenyl)propyl]-1,1-dimethylguanidine |
| SMILES | COc1ccc(CCCN/C(=N/Cc2ccccc2)N(C)C)cc1OC |
| InChI | InChI=1S/C21H29N3O2/c1-24(2)21(23-16-18-9-6-5-7-10-18)22-14-8-11-17-12-13-19(25-3)20(15-17)26-4/h5-7,9-10,12-13,15H,8,11,14,16H2,1-4H3,(H,22,23) |
| InChIKey | CXIXGUYSLGMPKV-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|