C22H32IN3O4 — CID 111273186
3-ethyl-1-methyl-1-(2-phenoxyethyl)-2-[(3,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide (PubChem CID 111273186) has the molecular formula C22H32IN3O4 and a molecular weight of 529.42 g/mol. Its IUPAC name is 3-ethyl-1-methyl-1-(2-phenoxyethyl)-2-[(3,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 3-ethyl-1-methyl-1-(2-phenoxyethyl)-2-[(3,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111273186 |
| Molecular Formula | C22H32IN3O4 |
| Molecular Weight | 529.42 g/mol |
| Exact Mass | 529.14 |
| IUPAC Name | 3-ethyl-1-methyl-1-(2-phenoxyethyl)-2-[(3,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(OC)c(OC)c(OC)c1)N(C)CCOc1ccccc1.I |
| InChI | InChI=1S/C22H31N3O4.HI/c1-6-23-22(25(2)12-13-29-18-10-8-7-9-11-18)24-16-17-14-19(26-3)21(28-5)20(15-17)27-4;/h7-11,14-15H,6,12-13,16H2,1-5H3,(H,23,24);1H |
| InChIKey | PWJOJFZGNQXMKL-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 64.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.42 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|