C21H28N4O2 — CID 111273983
N-[3-[[[ethylamino-[methyl(2-phenoxyethyl)amino]methylidene]amino]methyl]phenyl]acetamide (PubChem CID 111273983) has the molecular formula C21H28N4O2 and a molecular weight of 368.48 g/mol. Its IUPAC name is N-[3-[[[ethylamino-[methyl(2-phenoxyethyl)amino]methylidene]amino]methyl]phenyl]acetamide.
| Compound Name | N-[3-[[[ethylamino-[methyl(2-phenoxyethyl)amino]methylidene]amino]methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 111273983 |
| Molecular Formula | C21H28N4O2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | N-[3-[[[ethylamino-[methyl(2-phenoxyethyl)amino]methylidene]amino]methyl]phenyl]acetamide |
| SMILES | CCN/C(=N\Cc1cccc(NC(C)=O)c1)N(C)CCOc1ccccc1 |
| InChI | InChI=1S/C21H28N4O2/c1-4-22-21(25(3)13-14-27-20-11-6-5-7-12-20)23-16-18-9-8-10-19(15-18)24-17(2)26/h5-12,15H,4,13-14,16H2,1-3H3,(H,22,23)(H,24,26) |
| InChIKey | FIJRHWZMWLNLKX-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|