C19H27F2N5O2 — CID 111246253
1-[2-(3,4-diethoxyphenyl)ethyl]-3-[[1-(difluoromethyl)imidazol-2-yl]methyl]-2-methylguanidine (PubChem CID 111246253) has the molecular formula C19H27F2N5O2 and a molecular weight of 395.45 g/mol. Its IUPAC name is 1-[2-(3,4-diethoxyphenyl)ethyl]-3-[[1-(difluoromethyl)imidazol-2-yl]methyl]-2-methylguanidine.
| Compound Name | 1-[2-(3,4-diethoxyphenyl)ethyl]-3-[[1-(difluoromethyl)imidazol-2-yl]methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111246253 |
| Molecular Formula | C19H27F2N5O2 |
| Molecular Weight | 395.45 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | 1-[2-(3,4-diethoxyphenyl)ethyl]-3-[[1-(difluoromethyl)imidazol-2-yl]methyl]-2-methylguanidine |
| SMILES | CCOc1ccc(CCN/C(=N/C)NCc2nccn2C(F)F)cc1OCC |
| InChI | InChI=1S/C19H27F2N5O2/c1-4-27-15-7-6-14(12-16(15)28-5-2)8-9-24-19(22-3)25-13-17-23-10-11-26(17)18(20)21/h6-7,10-12,18H,4-5,8-9,13H2,1-3H3,(H2,22,24,25) |
| InChIKey | NYXJWKVCUVQPMF-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.45 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|