C17H23F2N5O2 — CID 111214649
1-[[1-(difluoromethyl)imidazol-2-yl]methyl]-3-[2-(3,4-dimethoxyphenyl)ethyl]-2-methylguanidine (PubChem CID 111214649) has the molecular formula C17H23F2N5O2 and a molecular weight of 367.40 g/mol. Its IUPAC name is 1-[[1-(difluoromethyl)imidazol-2-yl]methyl]-3-[2-(3,4-dimethoxyphenyl)ethyl]-2-methylguanidine.
| Compound Name | 1-[[1-(difluoromethyl)imidazol-2-yl]methyl]-3-[2-(3,4-dimethoxyphenyl)ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111214649 |
| Molecular Formula | C17H23F2N5O2 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | 1-[[1-(difluoromethyl)imidazol-2-yl]methyl]-3-[2-(3,4-dimethoxyphenyl)ethyl]-2-methylguanidine |
| SMILES | C/N=C(/NCCc1ccc(OC)c(OC)c1)NCc1nccn1C(F)F |
| InChI | InChI=1S/C17H23F2N5O2/c1-20-17(23-11-15-21-8-9-24(15)16(18)19)22-7-6-12-4-5-13(25-2)14(10-12)26-3/h4-5,8-10,16H,6-7,11H2,1-3H3,(H2,20,22,23) |
| InChIKey | CGSCPHPELHYZQJ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|