C16H21F2N5O2 — CID 111878525
1-[[1-(difluoromethyl)imidazol-2-yl]methyl]-3-[(2,4-dimethoxyphenyl)methyl]-2-methylguanidine (PubChem CID 111878525) has the molecular formula C16H21F2N5O2 and a molecular weight of 353.37 g/mol. Its IUPAC name is 1-[[1-(difluoromethyl)imidazol-2-yl]methyl]-3-[(2,4-dimethoxyphenyl)methyl]-2-methylguanidine.
| Compound Name | 1-[[1-(difluoromethyl)imidazol-2-yl]methyl]-3-[(2,4-dimethoxyphenyl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111878525 |
| Molecular Formula | C16H21F2N5O2 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 1-[[1-(difluoromethyl)imidazol-2-yl]methyl]-3-[(2,4-dimethoxyphenyl)methyl]-2-methylguanidine |
| SMILES | C/N=C(/NCc1ccc(OC)cc1OC)NCc1nccn1C(F)F |
| InChI | InChI=1S/C16H21F2N5O2/c1-19-16(22-10-14-20-6-7-23(14)15(17)18)21-9-11-4-5-12(24-2)8-13(11)25-3/h4-8,15H,9-10H2,1-3H3,(H2,19,21,22) |
| InChIKey | FPYZVQIMRVUZKK-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|