C18H27FIN3O2S — CID 111252006
methyl 1-[N-[3-(4-fluorophenyl)sulfanylpropyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide (PubChem CID 111252006) has the molecular formula C18H27FIN3O2S and a molecular weight of 495.40 g/mol. Its IUPAC name is methyl 1-[N-[3-(4-fluorophenyl)sulfanylpropyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide.
| Compound Name | methyl 1-[N-[3-(4-fluorophenyl)sulfanylpropyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111252006 |
| Molecular Formula | C18H27FIN3O2S |
| Molecular Weight | 495.40 g/mol |
| Exact Mass | 495.09 |
| IUPAC Name | methyl 1-[N-[3-(4-fluorophenyl)sulfanylpropyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide |
| SMILES | C/N=C(\NCCCSc1ccc(F)cc1)N1CCC(C(=O)OC)CC1.I |
| InChI | InChI=1S/C18H26FN3O2S.HI/c1-20-18(22-11-8-14(9-12-22)17(23)24-2)21-10-3-13-25-16-6-4-15(19)5-7-16;/h4-7,14H,3,8-13H2,1-2H3,(H,20,21);1H |
| InChIKey | RKLUCUMIDPLFFV-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.40 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|