C24H24F17NO2 — CID 11125285
8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,15-heptadecafluoro-N-(2-phenylmethoxyethyl)pentadecanamide (PubChem CID 11125285) has the molecular formula C24H24F17NO2 and a molecular weight of 681.43 g/mol. Its IUPAC name is 8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,15-heptadecafluoro-N-(2-phenylmethoxyethyl)pentadecanamide.
| Compound Name | 8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,15-heptadecafluoro-N-(2-phenylmethoxyethyl)pentadecanamide |
|---|---|
| PubChem CID | 11125285 |
| Molecular Formula | C24H24F17NO2 |
| Molecular Weight | 681.43 g/mol |
| Exact Mass | 681.15 |
| IUPAC Name | 8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,15-heptadecafluoro-N-(2-phenylmethoxyethyl)pentadecanamide |
| SMILES | O=C(CCCCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)NCCOCc1ccccc1 |
| InChI | InChI=1S/C24H24F17NO2/c25-17(26,11-7-2-1-6-10-16(43)42-12-13-44-14-15-8-4-3-5-9-15)18(27,28)19(29,30)20(31,32)21(33,34)22(35,36)23(37,38)24(39,40)41/h3-5,8-9H,1-2,6-7,10-14H2,(H,42,43) |
| InChIKey | AOPMUVZCBCBJKH-UHFFFAOYSA-N |
| XLogP | 8.67 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.43 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|