C24H39IN4O3 — CID 111253176
methyl 1-[N-ethyl-N'-[2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide (PubChem CID 111253176) has the molecular formula C24H39IN4O3 and a molecular weight of 558.51 g/mol. Its IUPAC name is methyl 1-[N-ethyl-N'-[2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide.
| Compound Name | methyl 1-[N-ethyl-N'-[2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111253176 |
| Molecular Formula | C24H39IN4O3 |
| Molecular Weight | 558.51 g/mol |
| Exact Mass | 558.21 |
| IUPAC Name | methyl 1-[N-ethyl-N'-[2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\CC(c1ccc(OC)cc1)N1CCCCC1)N1CCC(C(=O)OC)CC1.I |
| InChI | InChI=1S/C24H38N4O3.HI/c1-4-25-24(28-16-12-20(13-17-28)23(29)31-3)26-18-22(27-14-6-5-7-15-27)19-8-10-21(30-2)11-9-19;/h8-11,20,22H,4-7,12-18H2,1-3H3,(H,25,26);1H |
| InChIKey | SMPXKIXTIROCJM-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.51 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|