C25H38N6O — CID 111742825
N-ethyl-N'-[2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide (PubChem CID 111742825) has the molecular formula C25H38N6O and a molecular weight of 438.62 g/mol. Its IUPAC name is N-ethyl-N'-[2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111742825 |
| Molecular Formula | C25H38N6O |
| Molecular Weight | 438.62 g/mol |
| Exact Mass | 438.31 |
| IUPAC Name | N-ethyl-N'-[2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\CC(c1ccc(OC)cc1)N1CCCCC1)N1CCC(c2cnn(C)c2)C1 |
| InChI | InChI=1S/C25H38N6O/c1-4-26-25(31-15-12-21(19-31)22-16-28-29(2)18-22)27-17-24(30-13-6-5-7-14-30)20-8-10-23(32-3)11-9-20/h8-11,16,18,21,24H,4-7,12-15,17,19H2,1-3H3,(H,26,27) |
| InChIKey | TUTUCKUNTMZWGJ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 57.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.62 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|