C24H39IN6O — CID 111741606
N'-[2-(diethylamino)-2-(3-methoxyphenyl)ethyl]-N-ethyl-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111741606) has the molecular formula C24H39IN6O and a molecular weight of 554.52 g/mol. Its IUPAC name is N'-[2-(diethylamino)-2-(3-methoxyphenyl)ethyl]-N-ethyl-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[2-(diethylamino)-2-(3-methoxyphenyl)ethyl]-N-ethyl-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111741606 |
| Molecular Formula | C24H39IN6O |
| Molecular Weight | 554.52 g/mol |
| Exact Mass | 554.22 |
| IUPAC Name | N'-[2-(diethylamino)-2-(3-methoxyphenyl)ethyl]-N-ethyl-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CC(c1cccc(OC)c1)N(CC)CC)N1CCC(c2cnn(C)c2)C1.I |
| InChI | InChI=1S/C24H38N6O.HI/c1-6-25-24(30-13-12-20(18-30)21-15-27-28(4)17-21)26-16-23(29(7-2)8-3)19-10-9-11-22(14-19)31-5;/h9-11,14-15,17,20,23H,6-8,12-13,16,18H2,1-5H3,(H,25,26);1H |
| InChIKey | UFEFXVDNLMFBIN-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 57.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.52 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|