C23H33FN6O — CID 111742107
N-ethyl-N'-[2-(3-fluorophenyl)-2-morpholin-4-ylethyl]-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide (PubChem CID 111742107) has the molecular formula C23H33FN6O and a molecular weight of 428.56 g/mol. Its IUPAC name is N-ethyl-N'-[2-(3-fluorophenyl)-2-morpholin-4-ylethyl]-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[2-(3-fluorophenyl)-2-morpholin-4-ylethyl]-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111742107 |
| Molecular Formula | C23H33FN6O |
| Molecular Weight | 428.56 g/mol |
| Exact Mass | 428.27 |
| IUPAC Name | N-ethyl-N'-[2-(3-fluorophenyl)-2-morpholin-4-ylethyl]-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\CC(c1cccc(F)c1)N1CCOCC1)N1CCC(c2cnn(C)c2)C1 |
| InChI | InChI=1S/C23H33FN6O/c1-3-25-23(30-8-7-19(17-30)20-14-27-28(2)16-20)26-15-22(29-9-11-31-12-10-29)18-5-4-6-21(24)13-18/h4-6,13-14,16,19,22H,3,7-12,15,17H2,1-2H3,(H,25,26) |
| InChIKey | MXLYWKXABZGFPV-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 57.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.56 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|