C21H31FN4O3 — CID 111254047
methyl 1-[N-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate (PubChem CID 111254047) has the molecular formula C21H31FN4O3 and a molecular weight of 406.50 g/mol. Its IUPAC name is methyl 1-[N-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[N-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 111254047 |
| Molecular Formula | C21H31FN4O3 |
| Molecular Weight | 406.50 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | methyl 1-[N-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate |
| SMILES | C/N=C(\NCC(c1ccc(F)cc1)N1CCOCC1)N1CCC(C(=O)OC)CC1 |
| InChI | InChI=1S/C21H31FN4O3/c1-23-21(26-9-7-17(8-10-26)20(27)28-2)24-15-19(25-11-13-29-14-12-25)16-3-5-18(22)6-4-16/h3-6,17,19H,7-15H2,1-2H3,(H,23,24) |
| InChIKey | YAKMJWNIHLKHQZ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.50 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|