C15H27F3N4O2 — CID 111254061
methyl 1-[N'-methyl-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]carbamimidoyl]piperidine-4-carboxylate (PubChem CID 111254061) has the molecular formula C15H27F3N4O2 and a molecular weight of 352.40 g/mol. Its IUPAC name is methyl 1-[N'-methyl-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]carbamimidoyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[N'-methyl-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]carbamimidoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 111254061 |
| Molecular Formula | C15H27F3N4O2 |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.21 |
| IUPAC Name | methyl 1-[N'-methyl-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]carbamimidoyl]piperidine-4-carboxylate |
| SMILES | C/N=C(\NCCCN(C)CC(F)(F)F)N1CCC(C(=O)OC)CC1 |
| InChI | InChI=1S/C15H27F3N4O2/c1-19-14(20-7-4-8-21(2)11-15(16,17)18)22-9-5-12(6-10-22)13(23)24-3/h12H,4-11H2,1-3H3,(H,19,20) |
| InChIKey | ZVFHBVYAUKLSEA-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|