C21H34IN3O3 — CID 111254092
methyl 1-[N'-methyl-N-[3-(2,3,5-trimethylphenoxy)propyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide (PubChem CID 111254092) has the molecular formula C21H34IN3O3 and a molecular weight of 503.43 g/mol. Its IUPAC name is methyl 1-[N'-methyl-N-[3-(2,3,5-trimethylphenoxy)propyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide.
| Compound Name | methyl 1-[N'-methyl-N-[3-(2,3,5-trimethylphenoxy)propyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111254092 |
| Molecular Formula | C21H34IN3O3 |
| Molecular Weight | 503.43 g/mol |
| Exact Mass | 503.16 |
| IUPAC Name | methyl 1-[N'-methyl-N-[3-(2,3,5-trimethylphenoxy)propyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide |
| SMILES | C/N=C(\NCCCOc1cc(C)cc(C)c1C)N1CCC(C(=O)OC)CC1.I |
| InChI | InChI=1S/C21H33N3O3.HI/c1-15-13-16(2)17(3)19(14-15)27-12-6-9-23-21(22-4)24-10-7-18(8-11-24)20(25)26-5;/h13-14,18H,6-12H2,1-5H3,(H,22,23);1H |
| InChIKey | BECNHHYKKSOOFT-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.43 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|