C19H29IN4O4 — CID 111254556
methyl 1-[N-[2-[(3-methoxybenzoyl)amino]ethyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide (PubChem CID 111254556) has the molecular formula C19H29IN4O4 and a molecular weight of 504.37 g/mol. Its IUPAC name is methyl 1-[N-[2-[(3-methoxybenzoyl)amino]ethyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide.
| Compound Name | methyl 1-[N-[2-[(3-methoxybenzoyl)amino]ethyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111254556 |
| Molecular Formula | C19H29IN4O4 |
| Molecular Weight | 504.37 g/mol |
| Exact Mass | 504.12 |
| IUPAC Name | methyl 1-[N-[2-[(3-methoxybenzoyl)amino]ethyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide |
| SMILES | C/N=C(\NCCNC(=O)c1cccc(OC)c1)N1CCC(C(=O)OC)CC1.I |
| InChI | InChI=1S/C19H28N4O4.HI/c1-20-19(23-11-7-14(8-12-23)18(25)27-3)22-10-9-21-17(24)15-5-4-6-16(13-15)26-2;/h4-6,13-14H,7-12H2,1-3H3,(H,20,22)(H,21,24);1H |
| InChIKey | UBOPANZKHVMBRH-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.37 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|