C18H24Cl2N4O3 — CID 111255019
methyl 1-[N-[2-[(3,4-dichlorobenzoyl)amino]ethyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate (PubChem CID 111255019) has the molecular formula C18H24Cl2N4O3 and a molecular weight of 415.32 g/mol. Its IUPAC name is methyl 1-[N-[2-[(3,4-dichlorobenzoyl)amino]ethyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[N-[2-[(3,4-dichlorobenzoyl)amino]ethyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 111255019 |
| Molecular Formula | C18H24Cl2N4O3 |
| Molecular Weight | 415.32 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | methyl 1-[N-[2-[(3,4-dichlorobenzoyl)amino]ethyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate |
| SMILES | C/N=C(\NCCNC(=O)c1ccc(Cl)c(Cl)c1)N1CCC(C(=O)OC)CC1 |
| InChI | InChI=1S/C18H24Cl2N4O3/c1-21-18(24-9-5-12(6-10-24)17(26)27-2)23-8-7-22-16(25)13-3-4-14(19)15(20)11-13/h3-4,11-12H,5-10H2,1-2H3,(H,21,23)(H,22,25) |
| InChIKey | VARBEQYTJGAHGN-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.32 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|