C48H56N2O8 — CID 11125637
bis[4-[(6R,7R,7aS)-3,3-dimethyl-5-oxo-6-propan-2-yl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-7-yl]naphthalen-1-yl] hexanedioate (PubChem CID 11125637) has the molecular formula C48H56N2O8 and a molecular weight of 788.98 g/mol. Its IUPAC name is bis[4-[(6R,7R,7aS)-3,3-dimethyl-5-oxo-6-propan-2-yl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-7-yl]naphthalen-1-yl] hexanedioate.
| Compound Name | bis[4-[(6R,7R,7aS)-3,3-dimethyl-5-oxo-6-propan-2-yl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-7-yl]naphthalen-1-yl] hexanedioate |
|---|---|
| PubChem CID | 11125637 |
| Molecular Formula | C48H56N2O8 |
| Molecular Weight | 788.98 g/mol |
| Exact Mass | 788.40 |
| IUPAC Name | bis[4-[(6R,7R,7aS)-3,3-dimethyl-5-oxo-6-propan-2-yl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-7-yl]naphthalen-1-yl] hexanedioate |
| SMILES | CC(C)[C@H]1C(=O)N2[C@H](COC2(C)C)[C@H]1c1ccc(OC(=O)CCCCC(=O)Oc2ccc([C@H]3[C@@H](C(C)C)C(=O)N4[C@@H]3COC4(C)C)c3ccccc23)c2ccccc12 |
| InChI | InChI=1S/C48H56N2O8/c1-27(2)41-43(35-25-55-47(5,6)49(35)45(41)53)33-21-23-37(31-17-11-9-15-29(31)33)57-39(51)19-13-14-20-40(52)58-38-24-22-34(30-16-10-12-18-32(30)38)44-36-26-56-48(7,8)50(36)46(54)42(44)28(3)4/h9-12,15-18,21-24,27-28,35-36,41-44H,13-14,19-20,25-26H2,1-8H3/t35-,36-,41-,42-,43-,44-/m1/s1 |
| InChIKey | XGZYCFRXKSISIR-QZSXPNOESA-N |
| XLogP | 8.73 |
| TPSA | 111.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.98 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|