C20H35IN6O2S — CID 111256682
2-methyl-1-(4-methylcyclohexyl)-3-[2-(4-pyridin-2-ylpiperazin-1-yl)sulfonylethyl]guanidine;hydroiodide (PubChem CID 111256682) has the molecular formula C20H35IN6O2S and a molecular weight of 550.51 g/mol. Its IUPAC name is 2-methyl-1-(4-methylcyclohexyl)-3-[2-(4-pyridin-2-ylpiperazin-1-yl)sulfonylethyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-(4-methylcyclohexyl)-3-[2-(4-pyridin-2-ylpiperazin-1-yl)sulfonylethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111256682 |
| Molecular Formula | C20H35IN6O2S |
| Molecular Weight | 550.51 g/mol |
| Exact Mass | 550.16 |
| IUPAC Name | 2-methyl-1-(4-methylcyclohexyl)-3-[2-(4-pyridin-2-ylpiperazin-1-yl)sulfonylethyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCS(=O)(=O)N1CCN(c2ccccn2)CC1)NC1CCC(C)CC1.I |
| InChI | InChI=1S/C20H34N6O2S.HI/c1-17-6-8-18(9-7-17)24-20(21-2)23-11-16-29(27,28)26-14-12-25(13-15-26)19-5-3-4-10-22-19;/h3-5,10,17-18H,6-9,11-16H2,1-2H3,(H2,21,23,24);1H |
| InChIKey | OVTMDMZPMKPUMY-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 89.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.51 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|