C18H31IN6O2S — CID 110990770
1-cyclopentyl-2-methyl-3-[2-(4-pyridin-2-ylpiperazin-1-yl)sulfonylethyl]guanidine;hydroiodide (PubChem CID 110990770) has the molecular formula C18H31IN6O2S and a molecular weight of 522.46 g/mol. Its IUPAC name is 1-cyclopentyl-2-methyl-3-[2-(4-pyridin-2-ylpiperazin-1-yl)sulfonylethyl]guanidine;hydroiodide.
| Compound Name | 1-cyclopentyl-2-methyl-3-[2-(4-pyridin-2-ylpiperazin-1-yl)sulfonylethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110990770 |
| Molecular Formula | C18H31IN6O2S |
| Molecular Weight | 522.46 g/mol |
| Exact Mass | 522.13 |
| IUPAC Name | 1-cyclopentyl-2-methyl-3-[2-(4-pyridin-2-ylpiperazin-1-yl)sulfonylethyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCS(=O)(=O)N1CCN(c2ccccn2)CC1)NC1CCCC1.I |
| InChI | InChI=1S/C18H30N6O2S.HI/c1-19-18(22-16-6-2-3-7-16)21-10-15-27(25,26)24-13-11-23(12-14-24)17-8-4-5-9-20-17;/h4-5,8-9,16H,2-3,6-7,10-15H2,1H3,(H2,19,21,22);1H |
| InChIKey | GGJBKFFPFDENNI-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 89.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.46 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|