C15H25IN4S — CID 111258792
1-[(1-cyclopropylpyrrolidin-3-yl)methyl]-2-methyl-3-(thiophen-2-ylmethyl)guanidine;hydroiodide (PubChem CID 111258792) has the molecular formula C15H25IN4S and a molecular weight of 420.36 g/mol. Its IUPAC name is 1-[(1-cyclopropylpyrrolidin-3-yl)methyl]-2-methyl-3-(thiophen-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[(1-cyclopropylpyrrolidin-3-yl)methyl]-2-methyl-3-(thiophen-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111258792 |
| Molecular Formula | C15H25IN4S |
| Molecular Weight | 420.36 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | 1-[(1-cyclopropylpyrrolidin-3-yl)methyl]-2-methyl-3-(thiophen-2-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1cccs1)NCC1CCN(C2CC2)C1.I |
| InChI | InChI=1S/C15H24N4S.HI/c1-16-15(18-10-14-3-2-8-20-14)17-9-12-6-7-19(11-12)13-4-5-13;/h2-3,8,12-13H,4-7,9-11H2,1H3,(H2,16,17,18);1H |
| InChIKey | REYKFEDAHFLHJN-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.36 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|