C13H21F3N4S — CID 111259199
2-methyl-1-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-3-(thiophen-2-ylmethyl)guanidine (PubChem CID 111259199) has the molecular formula C13H21F3N4S and a molecular weight of 322.40 g/mol. Its IUPAC name is 2-methyl-1-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-3-(thiophen-2-ylmethyl)guanidine.
| Compound Name | 2-methyl-1-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-3-(thiophen-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111259199 |
| Molecular Formula | C13H21F3N4S |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 2-methyl-1-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-3-(thiophen-2-ylmethyl)guanidine |
| SMILES | C/N=C(\NCCCN(C)CC(F)(F)F)NCc1cccs1 |
| InChI | InChI=1S/C13H21F3N4S/c1-17-12(19-9-11-5-3-8-21-11)18-6-4-7-20(2)10-13(14,15)16/h3,5,8H,4,6-7,9-10H2,1-2H3,(H2,17,18,19) |
| InChIKey | HKAMNPCSNHNIMJ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|