C22H36FN5O — CID 111261663
1-ethyl-3-[(1-ethylpyrrolidin-2-yl)methyl]-2-[2-(3-fluorophenyl)-2-morpholin-4-ylethyl]guanidine (PubChem CID 111261663) has the molecular formula C22H36FN5O and a molecular weight of 405.56 g/mol. Its IUPAC name is 1-ethyl-3-[(1-ethylpyrrolidin-2-yl)methyl]-2-[2-(3-fluorophenyl)-2-morpholin-4-ylethyl]guanidine.
| Compound Name | 1-ethyl-3-[(1-ethylpyrrolidin-2-yl)methyl]-2-[2-(3-fluorophenyl)-2-morpholin-4-ylethyl]guanidine |
|---|---|
| PubChem CID | 111261663 |
| Molecular Formula | C22H36FN5O |
| Molecular Weight | 405.56 g/mol |
| Exact Mass | 405.29 |
| IUPAC Name | 1-ethyl-3-[(1-ethylpyrrolidin-2-yl)methyl]-2-[2-(3-fluorophenyl)-2-morpholin-4-ylethyl]guanidine |
| SMILES | CCN/C(=N\CC(c1cccc(F)c1)N1CCOCC1)NCC1CCCN1CC |
| InChI | InChI=1S/C22H36FN5O/c1-3-24-22(25-16-20-9-6-10-27(20)4-2)26-17-21(28-11-13-29-14-12-28)18-7-5-8-19(23)15-18/h5,7-8,15,20-21H,3-4,6,9-14,16-17H2,1-2H3,(H2,24,25,26) |
| InChIKey | VHKWAGUJMHCAGE-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 52.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.56 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|