C20H33F2N5 — CID 111794890
2-[2-(2,6-difluorophenyl)-2-(dimethylamino)ethyl]-1-ethyl-3-[(1-ethylpyrrolidin-2-yl)methyl]guanidine (PubChem CID 111794890) has the molecular formula C20H33F2N5 and a molecular weight of 381.52 g/mol. Its IUPAC name is 2-[2-(2,6-difluorophenyl)-2-(dimethylamino)ethyl]-1-ethyl-3-[(1-ethylpyrrolidin-2-yl)methyl]guanidine.
| Compound Name | 2-[2-(2,6-difluorophenyl)-2-(dimethylamino)ethyl]-1-ethyl-3-[(1-ethylpyrrolidin-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111794890 |
| Molecular Formula | C20H33F2N5 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.27 |
| IUPAC Name | 2-[2-(2,6-difluorophenyl)-2-(dimethylamino)ethyl]-1-ethyl-3-[(1-ethylpyrrolidin-2-yl)methyl]guanidine |
| SMILES | CCN/C(=N\CC(c1c(F)cccc1F)N(C)C)NCC1CCCN1CC |
| InChI | InChI=1S/C20H33F2N5/c1-5-23-20(24-13-15-9-8-12-27(15)6-2)25-14-18(26(3)4)19-16(21)10-7-11-17(19)22/h7,10-11,15,18H,5-6,8-9,12-14H2,1-4H3,(H2,23,24,25) |
| InChIKey | KTGMPOLQFJDIRV-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|