C20H27FN4 — CID 111265331
1-[2-[4-(dimethylamino)phenyl]ethyl]-3-ethyl-2-[(2-fluorophenyl)methyl]guanidine (PubChem CID 111265331) has the molecular formula C20H27FN4 and a molecular weight of 342.46 g/mol. Its IUPAC name is 1-[2-[4-(dimethylamino)phenyl]ethyl]-3-ethyl-2-[(2-fluorophenyl)methyl]guanidine.
| Compound Name | 1-[2-[4-(dimethylamino)phenyl]ethyl]-3-ethyl-2-[(2-fluorophenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111265331 |
| Molecular Formula | C20H27FN4 |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | 1-[2-[4-(dimethylamino)phenyl]ethyl]-3-ethyl-2-[(2-fluorophenyl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccccc1F)NCCc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C20H27FN4/c1-4-22-20(24-15-17-7-5-6-8-19(17)21)23-14-13-16-9-11-18(12-10-16)25(2)3/h5-12H,4,13-15H2,1-3H3,(H2,22,23,24) |
| InChIKey | MSUHPMRADUFZQA-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|