C19H29FN4O — CID 111266333
1-ethyl-2-[(2-fluorophenyl)methyl]-3-[3-(3-methylpiperidin-1-yl)-3-oxopropyl]guanidine (PubChem CID 111266333) has the molecular formula C19H29FN4O and a molecular weight of 348.47 g/mol. Its IUPAC name is 1-ethyl-2-[(2-fluorophenyl)methyl]-3-[3-(3-methylpiperidin-1-yl)-3-oxopropyl]guanidine.
| Compound Name | 1-ethyl-2-[(2-fluorophenyl)methyl]-3-[3-(3-methylpiperidin-1-yl)-3-oxopropyl]guanidine |
|---|---|
| PubChem CID | 111266333 |
| Molecular Formula | C19H29FN4O |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | 1-ethyl-2-[(2-fluorophenyl)methyl]-3-[3-(3-methylpiperidin-1-yl)-3-oxopropyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccccc1F)NCCC(=O)N1CCCC(C)C1 |
| InChI | InChI=1S/C19H29FN4O/c1-3-21-19(23-13-16-8-4-5-9-17(16)20)22-11-10-18(25)24-12-6-7-15(2)14-24/h4-5,8-9,15H,3,6-7,10-14H2,1-2H3,(H2,21,22,23) |
| InChIKey | QZRCNJRWLYSQLQ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|