C17H27F3N4 — CID 111268397
1-[2-(diethylamino)propyl]-2-methyl-3-[[3-(trifluoromethyl)phenyl]methyl]guanidine (PubChem CID 111268397) has the molecular formula C17H27F3N4 and a molecular weight of 344.43 g/mol. Its IUPAC name is 1-[2-(diethylamino)propyl]-2-methyl-3-[[3-(trifluoromethyl)phenyl]methyl]guanidine.
| Compound Name | 1-[2-(diethylamino)propyl]-2-methyl-3-[[3-(trifluoromethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111268397 |
| Molecular Formula | C17H27F3N4 |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | 1-[2-(diethylamino)propyl]-2-methyl-3-[[3-(trifluoromethyl)phenyl]methyl]guanidine |
| SMILES | CCN(CC)C(C)CN/C(=N\C)NCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H27F3N4/c1-5-24(6-2)13(3)11-22-16(21-4)23-12-14-8-7-9-15(10-14)17(18,19)20/h7-10,13H,5-6,11-12H2,1-4H3,(H2,21,22,23) |
| InChIKey | JGRBRZNSHNDHFN-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|