C10H16OSi — CID 11126871
2-[(2R,3R)-3-ethenyl-3-methyloxiran-2-yl]ethynyl-trimethylsilane (PubChem CID 11126871) has the molecular formula C10H16OSi and a molecular weight of 180.32 g/mol. Its IUPAC name is 2-[(2R,3R)-3-ethenyl-3-methyloxiran-2-yl]ethynyl-trimethylsilane.
| Compound Name | 2-[(2R,3R)-3-ethenyl-3-methyloxiran-2-yl]ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 11126871 |
| Molecular Formula | C10H16OSi |
| Molecular Weight | 180.32 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | 2-[(2R,3R)-3-ethenyl-3-methyloxiran-2-yl]ethynyl-trimethylsilane |
| SMILES | C=C[C@@]1(C)O[C@@H]1C#C[Si](C)(C)C |
| InChI | InChI=1S/C10H16OSi/c1-6-10(2)9(11-10)7-8-12(3,4)5/h6,9H,1H2,2-5H3/t9-,10-/m1/s1 |
| InChIKey | ZQRZKNABPAYYOQ-NXEZZACHSA-N |
| XLogP | 2.21 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.32 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|