C23H39N5O2 — CID 111268819
N-ethyl-N'-[2-(4-ethylpiperazin-1-yl)propyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carboximidamide (PubChem CID 111268819) has the molecular formula C23H39N5O2 and a molecular weight of 417.60 g/mol. Its IUPAC name is N-ethyl-N'-[2-(4-ethylpiperazin-1-yl)propyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carboximidamide.
| Compound Name | N-ethyl-N'-[2-(4-ethylpiperazin-1-yl)propyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carboximidamide |
|---|---|
| PubChem CID | 111268819 |
| Molecular Formula | C23H39N5O2 |
| Molecular Weight | 417.60 g/mol |
| Exact Mass | 417.31 |
| IUPAC Name | N-ethyl-N'-[2-(4-ethylpiperazin-1-yl)propyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carboximidamide |
| SMILES | CCN/C(=N\CC(C)N1CCN(CC)CC1)N1CCc2cc(OC)c(OC)cc2C1 |
| InChI | InChI=1S/C23H39N5O2/c1-6-24-23(25-16-18(3)27-12-10-26(7-2)11-13-27)28-9-8-19-14-21(29-4)22(30-5)15-20(19)17-28/h14-15,18H,6-13,16-17H2,1-5H3,(H,24,25) |
| InChIKey | RRPUZGOZYGBCSG-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.60 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|