C20H25IN4O3 — CID 111270264
4-[[[(2,3-dihydro-1,4-benzodioxin-3-ylmethylamino)-(ethylamino)methylidene]amino]methyl]benzamide;hydroiodide (PubChem CID 111270264) has the molecular formula C20H25IN4O3 and a molecular weight of 496.35 g/mol. Its IUPAC name is 4-[[[(2,3-dihydro-1,4-benzodioxin-3-ylmethylamino)-(ethylamino)methylidene]amino]methyl]benzamide;hydroiodide.
| Compound Name | 4-[[[(2,3-dihydro-1,4-benzodioxin-3-ylmethylamino)-(ethylamino)methylidene]amino]methyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111270264 |
| Molecular Formula | C20H25IN4O3 |
| Molecular Weight | 496.35 g/mol |
| Exact Mass | 496.10 |
| IUPAC Name | 4-[[[(2,3-dihydro-1,4-benzodioxin-3-ylmethylamino)-(ethylamino)methylidene]amino]methyl]benzamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(C(N)=O)cc1)NCC1COc2ccccc2O1.I |
| InChI | InChI=1S/C20H24N4O3.HI/c1-2-22-20(23-11-14-7-9-15(10-8-14)19(21)25)24-12-16-13-26-17-5-3-4-6-18(17)27-16;/h3-10,16H,2,11-13H2,1H3,(H2,21,25)(H2,22,23,24);1H |
| InChIKey | HMBSGVJIFMBWTM-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.35 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|