C24H27IN4O4 — CID 111270306
N-[3-[[[(2,3-dihydro-1,4-benzodioxin-3-ylmethylamino)-(ethylamino)methylidene]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide (PubChem CID 111270306) has the molecular formula C24H27IN4O4 and a molecular weight of 562.41 g/mol. Its IUPAC name is N-[3-[[[(2,3-dihydro-1,4-benzodioxin-3-ylmethylamino)-(ethylamino)methylidene]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide.
| Compound Name | N-[3-[[[(2,3-dihydro-1,4-benzodioxin-3-ylmethylamino)-(ethylamino)methylidene]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111270306 |
| Molecular Formula | C24H27IN4O4 |
| Molecular Weight | 562.41 g/mol |
| Exact Mass | 562.11 |
| IUPAC Name | N-[3-[[[(2,3-dihydro-1,4-benzodioxin-3-ylmethylamino)-(ethylamino)methylidene]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(NC(=O)c2ccco2)c1)NCC1COc2ccccc2O1.I |
| InChI | InChI=1S/C24H26N4O4.HI/c1-2-25-24(27-15-19-16-31-20-9-3-4-10-21(20)32-19)26-14-17-7-5-8-18(13-17)28-23(29)22-11-6-12-30-22;/h3-13,19H,2,14-16H2,1H3,(H,28,29)(H2,25,26,27);1H |
| InChIKey | ACFAVWUDGKLAFB-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.41 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|