C6H6N4O4 — CID 11127226
3,6-diaminopyrazine-2,5-dicarboxylic acid (PubChem CID 11127226) has the molecular formula C6H6N4O4 and a molecular weight of 198.14 g/mol. Its IUPAC name is 3,6-diaminopyrazine-2,5-dicarboxylic acid.
| Compound Name | 3,6-diaminopyrazine-2,5-dicarboxylic acid |
|---|---|
| PubChem CID | 11127226 |
| Molecular Formula | C6H6N4O4 |
| Molecular Weight | 198.14 g/mol |
| Exact Mass | 198.04 |
| IUPAC Name | 3,6-diaminopyrazine-2,5-dicarboxylic acid |
| SMILES | Nc1nc(C(=O)O)c(N)nc1C(=O)O |
| InChI | InChI=1S/C6H6N4O4/c7-3-1(5(11)12)9-4(8)2(10-3)6(13)14/h(H2,8,9)(H2,7,10)(H,11,12)(H,13,14) |
| InChIKey | VELGYJCKWFALBF-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 152.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.14 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |