C9H10O5 — CID 11127228
(1R,2R,6R,7R)-7-prop-2-enyl-3,5,8,10-tetraoxatricyclo[5.2.1.02,6]decan-4-one (PubChem CID 11127228) has the molecular formula C9H10O5 and a molecular weight of 198.17 g/mol. Its IUPAC name is (1R,2R,6R,7R)-7-prop-2-enyl-3,5,8,10-tetraoxatricyclo[5.2.1.02,6]decan-4-one.
| Compound Name | (1R,2R,6R,7R)-7-prop-2-enyl-3,5,8,10-tetraoxatricyclo[5.2.1.02,6]decan-4-one |
|---|---|
| PubChem CID | 11127228 |
| Molecular Formula | C9H10O5 |
| Molecular Weight | 198.17 g/mol |
| Exact Mass | 198.05 |
| IUPAC Name | (1R,2R,6R,7R)-7-prop-2-enyl-3,5,8,10-tetraoxatricyclo[5.2.1.02,6]decan-4-one |
| SMILES | C=CC[C@@]12OC[C@@H](O1)[C@H]1OC(=O)O[C@H]12 |
| InChI | InChI=1S/C9H10O5/c1-2-3-9-7-6(12-8(10)13-7)5(14-9)4-11-9/h2,5-7H,1,3-4H2/t5-,6-,7-,9-/m1/s1 |
| InChIKey | JWIDRKISACVLOT-JXOAFFINSA-N |
| XLogP | 0.59 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.17 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|