C10H14O5 — CID 166083256
9-prop-2-enyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane (PubChem CID 166083256) has the molecular formula C10H14O5 and a molecular weight of 214.22 g/mol. Its IUPAC name is 9-prop-2-enyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane.
| Compound Name | 9-prop-2-enyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane |
|---|---|
| PubChem CID | 166083256 |
| Molecular Formula | C10H14O5 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 9-prop-2-enyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane |
| SMILES | C=CCC1OCOC2C1OC1OCOC12 |
| InChI | InChI=1S/C10H14O5/c1-2-3-6-7-8(12-4-11-6)9-10(15-7)14-5-13-9/h2,6-10H,1,3-5H2 |
| InChIKey | VLKYDBJABPZWJT-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|