C22H32N4OS — CID 111274075
1,2-dimethyl-1-(2-phenoxyethyl)-3-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]guanidine (PubChem CID 111274075) has the molecular formula C22H32N4OS and a molecular weight of 400.59 g/mol. Its IUPAC name is 1,2-dimethyl-1-(2-phenoxyethyl)-3-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]guanidine.
| Compound Name | 1,2-dimethyl-1-(2-phenoxyethyl)-3-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111274075 |
| Molecular Formula | C22H32N4OS |
| Molecular Weight | 400.59 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | 1,2-dimethyl-1-(2-phenoxyethyl)-3-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]guanidine |
| SMILES | C/N=C(/NCC1CCCN(Cc2cccs2)C1)N(C)CCOc1ccccc1 |
| InChI | InChI=1S/C22H32N4OS/c1-23-22(25(2)13-14-27-20-9-4-3-5-10-20)24-16-19-8-6-12-26(17-19)18-21-11-7-15-28-21/h3-5,7,9-11,15,19H,6,8,12-14,16-18H2,1-2H3,(H,23,24) |
| InChIKey | PHZDEJBYRNSNGP-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.59 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|