C20H27IN4O2 — CID 111276392
N-methyl-4-[[[N'-methyl-N-[2-(4-methylphenoxy)ethyl]carbamimidoyl]amino]methyl]benzamide;hydroiodide (PubChem CID 111276392) has the molecular formula C20H27IN4O2 and a molecular weight of 482.37 g/mol. Its IUPAC name is N-methyl-4-[[[N'-methyl-N-[2-(4-methylphenoxy)ethyl]carbamimidoyl]amino]methyl]benzamide;hydroiodide.
| Compound Name | N-methyl-4-[[[N'-methyl-N-[2-(4-methylphenoxy)ethyl]carbamimidoyl]amino]methyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111276392 |
| Molecular Formula | C20H27IN4O2 |
| Molecular Weight | 482.37 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | N-methyl-4-[[[N'-methyl-N-[2-(4-methylphenoxy)ethyl]carbamimidoyl]amino]methyl]benzamide;hydroiodide |
| SMILES | C/N=C(\NCCOc1ccc(C)cc1)NCc1ccc(C(=O)NC)cc1.I |
| InChI | InChI=1S/C20H26N4O2.HI/c1-15-4-10-18(11-5-15)26-13-12-23-20(22-3)24-14-16-6-8-17(9-7-16)19(25)21-2;/h4-11H,12-14H2,1-3H3,(H,21,25)(H2,22,23,24);1H |
| InChIKey | DIPVQIXQOLERQI-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.37 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|