C13H17NO2 — CID 11127779
(2R,3S,6S)-2-(hydroxymethyl)-3-methyl-6-phenylpiperidin-4-one (PubChem CID 11127779) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is (2R,3S,6S)-2-(hydroxymethyl)-3-methyl-6-phenylpiperidin-4-one.
| Compound Name | (2R,3S,6S)-2-(hydroxymethyl)-3-methyl-6-phenylpiperidin-4-one |
|---|---|
| PubChem CID | 11127779 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | (2R,3S,6S)-2-(hydroxymethyl)-3-methyl-6-phenylpiperidin-4-one |
| SMILES | C[C@@H]1C(=O)C[C@@H](c2ccccc2)N[C@H]1CO |
| InChI | InChI=1S/C13H17NO2/c1-9-12(8-15)14-11(7-13(9)16)10-5-3-2-4-6-10/h2-6,9,11-12,14-15H,7-8H2,1H3/t9-,11-,12-/m0/s1 |
| InChIKey | WLTCWFWCYXHZAD-DLOVCJGASA-N |
| XLogP | 1.29 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |