C21H32IN7O — CID 111280538
1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methyl-3-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111280538) has the molecular formula C21H32IN7O and a molecular weight of 525.44 g/mol. Its IUPAC name is 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methyl-3-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methyl-3-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111280538 |
| Molecular Formula | C21H32IN7O |
| Molecular Weight | 525.44 g/mol |
| Exact Mass | 525.17 |
| IUPAC Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methyl-3-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCn1nc(C)cc1C)NCc1ccc(N2CCNC(=O)C2)cc1.I |
| InChI | InChI=1S/C21H31N7O.HI/c1-16-13-17(2)28(26-16)11-4-9-24-21(22-3)25-14-18-5-7-19(8-6-18)27-12-10-23-20(29)15-27;/h5-8,13H,4,9-12,14-15H2,1-3H3,(H,23,29)(H2,22,24,25);1H |
| InChIKey | NQTONJDSMPKEEA-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 86.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.44 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|