C13H24O3 — CID 11128061
1-methoxy-2,2-bis[[(E)-prop-1-enoxy]methyl]butane (PubChem CID 11128061) has the molecular formula C13H24O3 and a molecular weight of 228.33 g/mol. Its IUPAC name is 1-methoxy-2,2-bis[[(E)-prop-1-enoxy]methyl]butane.
| Compound Name | 1-methoxy-2,2-bis[[(E)-prop-1-enoxy]methyl]butane |
|---|---|
| PubChem CID | 11128061 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | 1-methoxy-2,2-bis[[(E)-prop-1-enoxy]methyl]butane |
| SMILES | C/C=C/OCC(CC)(COC)CO/C=C/C |
| InChI | InChI=1S/C13H24O3/c1-5-8-15-11-13(7-3,10-14-4)12-16-9-6-2/h5-6,8-9H,7,10-12H2,1-4H3/b8-5+,9-6+ |
| InChIKey | BMFSFMKPPNJZBC-XVYDYJIPSA-N |
| XLogP | 3.13 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|