C20H23F3N4O2 — CID 111281709
2-[[ethylamino-[(2-methoxyphenyl)methyl-methylamino]methylidene]amino]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 111281709) has the molecular formula C20H23F3N4O2 and a molecular weight of 408.42 g/mol. Its IUPAC name is 2-[[ethylamino-[(2-methoxyphenyl)methyl-methylamino]methylidene]amino]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[[ethylamino-[(2-methoxyphenyl)methyl-methylamino]methylidene]amino]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 111281709 |
| Molecular Formula | C20H23F3N4O2 |
| Molecular Weight | 408.42 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 2-[[ethylamino-[(2-methoxyphenyl)methyl-methylamino]methylidene]amino]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | CCN/C(=N\CC(=O)Nc1ccc(F)c(F)c1F)N(C)Cc1ccccc1OC |
| InChI | InChI=1S/C20H23F3N4O2/c1-4-24-20(27(2)12-13-7-5-6-8-16(13)29-3)25-11-17(28)26-15-10-9-14(21)18(22)19(15)23/h5-10H,4,11-12H2,1-3H3,(H,24,25)(H,26,28) |
| InChIKey | RFTYSECMMXFMPX-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.42 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|