C17H24N4O2 — CID 111281839
3-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-1-[(2-methoxyphenyl)methyl]-1,2-dimethylguanidine (PubChem CID 111281839) has the molecular formula C17H24N4O2 and a molecular weight of 316.41 g/mol. Its IUPAC name is 3-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-1-[(2-methoxyphenyl)methyl]-1,2-dimethylguanidine.
| Compound Name | 3-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-1-[(2-methoxyphenyl)methyl]-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 111281839 |
| Molecular Formula | C17H24N4O2 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 3-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-1-[(2-methoxyphenyl)methyl]-1,2-dimethylguanidine |
| SMILES | C/N=C(\NCc1nc(C)c(C)o1)N(C)Cc1ccccc1OC |
| InChI | InChI=1S/C17H24N4O2/c1-12-13(2)23-16(20-12)10-19-17(18-3)21(4)11-14-8-6-7-9-15(14)22-5/h6-9H,10-11H2,1-5H3,(H,18,19) |
| InChIKey | PEKMXNUXXLVGOJ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 62.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|