C17H30N4O3S — CID 111282421
3-[3-[ethyl(methylsulfonyl)amino]propyl]-1-[(2-methoxyphenyl)methyl]-1,2-dimethylguanidine (PubChem CID 111282421) has the molecular formula C17H30N4O3S and a molecular weight of 370.52 g/mol. Its IUPAC name is 3-[3-[ethyl(methylsulfonyl)amino]propyl]-1-[(2-methoxyphenyl)methyl]-1,2-dimethylguanidine.
| Compound Name | 3-[3-[ethyl(methylsulfonyl)amino]propyl]-1-[(2-methoxyphenyl)methyl]-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 111282421 |
| Molecular Formula | C17H30N4O3S |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | 3-[3-[ethyl(methylsulfonyl)amino]propyl]-1-[(2-methoxyphenyl)methyl]-1,2-dimethylguanidine |
| SMILES | CCN(CCCN/C(=N\C)N(C)Cc1ccccc1OC)S(C)(=O)=O |
| InChI | InChI=1S/C17H30N4O3S/c1-6-21(25(5,22)23)13-9-12-19-17(18-2)20(3)14-15-10-7-8-11-16(15)24-4/h7-8,10-11H,6,9,12-14H2,1-5H3,(H,18,19) |
| InChIKey | BHNBZOUDOCPEOL-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|