C19H31F3IN5OS — CID 111284028
2-methyl-1-(2-morpholin-4-yl-2-thiophen-2-ylethyl)-3-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine;hydroiodide (PubChem CID 111284028) has the molecular formula C19H31F3IN5OS and a molecular weight of 561.46 g/mol. Its IUPAC name is 2-methyl-1-(2-morpholin-4-yl-2-thiophen-2-ylethyl)-3-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-(2-morpholin-4-yl-2-thiophen-2-ylethyl)-3-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111284028 |
| Molecular Formula | C19H31F3IN5OS |
| Molecular Weight | 561.46 g/mol |
| Exact Mass | 561.12 |
| IUPAC Name | 2-methyl-1-(2-morpholin-4-yl-2-thiophen-2-ylethyl)-3-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCC1CCN(CC(F)(F)F)C1)NCC(c1cccs1)N1CCOCC1.I |
| InChI | InChI=1S/C19H30F3N5OS.HI/c1-23-18(24-11-15-4-5-26(13-15)14-19(20,21)22)25-12-16(17-3-2-10-29-17)27-6-8-28-9-7-27;/h2-3,10,15-16H,4-9,11-14H2,1H3,(H2,23,24,25);1H |
| InChIKey | YZIBTDAXZKRNRD-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 52.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.46 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|