C21H35FIN5O — CID 111286262
1-[3-[[ethylamino-[(3-fluorophenyl)methyl-methylamino]methylidene]amino]propyl]-N,N-dimethylpyrrolidine-2-carboxamide;hydroiodide (PubChem CID 111286262) has the molecular formula C21H35FIN5O and a molecular weight of 519.45 g/mol. Its IUPAC name is 1-[3-[[ethylamino-[(3-fluorophenyl)methyl-methylamino]methylidene]amino]propyl]-N,N-dimethylpyrrolidine-2-carboxamide;hydroiodide.
| Compound Name | 1-[3-[[ethylamino-[(3-fluorophenyl)methyl-methylamino]methylidene]amino]propyl]-N,N-dimethylpyrrolidine-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111286262 |
| Molecular Formula | C21H35FIN5O |
| Molecular Weight | 519.45 g/mol |
| Exact Mass | 519.19 |
| IUPAC Name | 1-[3-[[ethylamino-[(3-fluorophenyl)methyl-methylamino]methylidene]amino]propyl]-N,N-dimethylpyrrolidine-2-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\CCCN1CCCC1C(=O)N(C)C)N(C)Cc1cccc(F)c1.I |
| InChI | InChI=1S/C21H34FN5O.HI/c1-5-23-21(26(4)16-17-9-6-10-18(22)15-17)24-12-8-14-27-13-7-11-19(27)20(28)25(2)3;/h6,9-10,15,19H,5,7-8,11-14,16H2,1-4H3,(H,23,24);1H |
| InChIKey | GQDBIXUKYGYGKQ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 51.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.45 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|