C13H19NO4 — CID 11128815
methyl (1R,2R,5R)-5-hydroxy-2-(pyrrolidine-1-carbonyl)cyclohex-3-ene-1-carboxylate (PubChem CID 11128815) has the molecular formula C13H19NO4 and a molecular weight of 253.30 g/mol. Its IUPAC name is methyl (1R,2R,5R)-5-hydroxy-2-(pyrrolidine-1-carbonyl)cyclohex-3-ene-1-carboxylate.
| Compound Name | methyl (1R,2R,5R)-5-hydroxy-2-(pyrrolidine-1-carbonyl)cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 11128815 |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | methyl (1R,2R,5R)-5-hydroxy-2-(pyrrolidine-1-carbonyl)cyclohex-3-ene-1-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@@H](O)C=C[C@H]1C(=O)N1CCCC1 |
| InChI | InChI=1S/C13H19NO4/c1-18-13(17)11-8-9(15)4-5-10(11)12(16)14-6-2-3-7-14/h4-5,9-11,15H,2-3,6-8H2,1H3/t9-,10+,11+/m0/s1 |
| InChIKey | TXNUUFNLLXSRAE-HBNTYKKESA-N |
| XLogP | 0.34 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|